C17H22BrF2N3O2S — CID 173487326
[[(2R)-2-[1-(3-bromophenyl)pyrazol-4-yl]-3,3-difluoro-4-hydroxybutan-2-yl]amino]-tert-butyl-oxidosulfanium (PubChem CID 173487326) has the molecular formula C17H22BrF2N3O2S and a molecular weight of 450.35 g/mol. Its IUPAC name is [[(2R)-2-[1-(3-bromophenyl)pyrazol-4-yl]-3,3-difluoro-4-hydroxybutan-2-yl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(2R)-2-[1-(3-bromophenyl)pyrazol-4-yl]-3,3-difluoro-4-hydroxybutan-2-yl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 173487326 |
| Molecular Formula | C17H22BrF2N3O2S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | [[(2R)-2-[1-(3-bromophenyl)pyrazol-4-yl]-3,3-difluoro-4-hydroxybutan-2-yl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@](C)(c1cnn(-c2cccc(Br)c2)c1)C(F)(F)CO |
| InChI | InChI=1S/C17H22BrF2N3O2S/c1-15(2,3)26(25)22-16(4,17(19,20)11-24)12-9-21-23(10-12)14-7-5-6-13(18)8-14/h5-10,22,24H,11H2,1-4H3/t16-,26?/m1/s1 |
| InChIKey | NXNOXPLFIMOKRS-DIERRCTGSA-N |
| XLogP | 3.53 |
| TPSA | 73.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|