C19H19F2N3O4S — CID 173489431
methyl 2-(4-amino-3-fluorophenyl)imino-2-(2-fluoro-4,5-dimethoxyphenyl)-N-methoxycarbonylethanimidothioate (PubChem CID 173489431) has the molecular formula C19H19F2N3O4S and a molecular weight of 423.44 g/mol. Its IUPAC name is methyl 2-(4-amino-3-fluorophenyl)imino-2-(2-fluoro-4,5-dimethoxyphenyl)-N-methoxycarbonylethanimidothioate.
| Compound Name | methyl 2-(4-amino-3-fluorophenyl)imino-2-(2-fluoro-4,5-dimethoxyphenyl)-N-methoxycarbonylethanimidothioate |
|---|---|
| PubChem CID | 173489431 |
| Molecular Formula | C19H19F2N3O4S |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | methyl 2-(4-amino-3-fluorophenyl)imino-2-(2-fluoro-4,5-dimethoxyphenyl)-N-methoxycarbonylethanimidothioate |
| SMILES | COC(=O)N=C(SC)/C(=N\c1ccc(N)c(F)c1)c1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C19H19F2N3O4S/c1-26-15-8-11(12(20)9-16(15)27-2)17(18(29-4)24-19(25)28-3)23-10-5-6-14(22)13(21)7-10/h5-9H,22H2,1-4H3/b23-17-,24-18? |
| InChIKey | HDSLFOXKIUNTIJ-YZVCTNDASA-N |
| XLogP | 4.21 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|