C22H24FN3O5S — CID 173480677
methyl 2-[(4-aminophenyl)methylimino]-2-(6-fluoro-9-methoxy-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-methoxycarbonylethanimidothioate (PubChem CID 173480677) has the molecular formula C22H24FN3O5S and a molecular weight of 461.52 g/mol. Its IUPAC name is methyl 2-[(4-aminophenyl)methylimino]-2-(6-fluoro-9-methoxy-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-methoxycarbonylethanimidothioate.
| Compound Name | methyl 2-[(4-aminophenyl)methylimino]-2-(6-fluoro-9-methoxy-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-methoxycarbonylethanimidothioate |
|---|---|
| PubChem CID | 173480677 |
| Molecular Formula | C22H24FN3O5S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | methyl 2-[(4-aminophenyl)methylimino]-2-(6-fluoro-9-methoxy-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-methoxycarbonylethanimidothioate |
| SMILES | COC(=O)N=C(SC)/C(=N\Cc1ccc(N)cc1)c1cc(OC)c2c(c1F)OCCCO2 |
| InChI | InChI=1S/C22H24FN3O5S/c1-28-16-11-15(17(23)20-19(16)30-9-4-10-31-20)18(21(32-3)26-22(27)29-2)25-12-13-5-7-14(24)8-6-13/h5-8,11H,4,9-10,12,24H2,1-3H3/b25-18-,26-21? |
| InChIKey | FRUKMOPJFNXIPX-LESVJEGASA-N |
| XLogP | 4.09 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|