C20H18FN3O4S — CID 59516865
methyl (1Z)-2-(4-cyanophenyl)imino-2-(2-fluoro-3,5-dimethoxyphenyl)-N-methoxycarbonylethanimidothioate (PubChem CID 59516865) has the molecular formula C20H18FN3O4S and a molecular weight of 415.45 g/mol. Its IUPAC name is methyl (1Z)-2-(4-cyanophenyl)imino-2-(2-fluoro-3,5-dimethoxyphenyl)-N-methoxycarbonylethanimidothioate.
| Compound Name | methyl (1Z)-2-(4-cyanophenyl)imino-2-(2-fluoro-3,5-dimethoxyphenyl)-N-methoxycarbonylethanimidothioate |
|---|---|
| PubChem CID | 59516865 |
| Molecular Formula | C20H18FN3O4S |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | methyl (1Z)-2-(4-cyanophenyl)imino-2-(2-fluoro-3,5-dimethoxyphenyl)-N-methoxycarbonylethanimidothioate |
| SMILES | COC(=O)/N=C(SC)/C(=N\c1ccc(C#N)cc1)c1cc(OC)cc(OC)c1F |
| InChI | InChI=1S/C20H18FN3O4S/c1-26-14-9-15(17(21)16(10-14)27-2)18(19(29-4)24-20(25)28-3)23-13-7-5-12(11-22)6-8-13/h5-10H,1-4H3/b23-18-,24-19- |
| InChIKey | IVKRISJVMVNNCD-KVOJEJHXSA-N |
| XLogP | 4.36 |
| TPSA | 93.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|