C27H33FN4O6SSi — CID 59511833
methyl (1Z)-2-[4-cyano-3-[(2-trimethylsilylethoxycarbonylamino)methyl]phenyl]imino-2-(2-fluoro-3,5-dimethoxyphenyl)-N-methoxycarbonylethanimidothioate (PubChem CID 59511833) has the molecular formula C27H33FN4O6SSi and a molecular weight of 588.73 g/mol. Its IUPAC name is methyl (1Z)-2-[4-cyano-3-[(2-trimethylsilylethoxycarbonylamino)methyl]phenyl]imino-2-(2-fluoro-3,5-dimethoxyphenyl)-N-methoxycarbonylethanimidothioate.
| Compound Name | methyl (1Z)-2-[4-cyano-3-[(2-trimethylsilylethoxycarbonylamino)methyl]phenyl]imino-2-(2-fluoro-3,5-dimethoxyphenyl)-N-methoxycarbonylethanimidothioate |
|---|---|
| PubChem CID | 59511833 |
| Molecular Formula | C27H33FN4O6SSi |
| Molecular Weight | 588.73 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | methyl (1Z)-2-[4-cyano-3-[(2-trimethylsilylethoxycarbonylamino)methyl]phenyl]imino-2-(2-fluoro-3,5-dimethoxyphenyl)-N-methoxycarbonylethanimidothioate |
| SMILES | COC(=O)/N=C(SC)/C(=N\c1ccc(C#N)c(CNC(=O)OCC[Si](C)(C)C)c1)c1cc(OC)cc(OC)c1F |
| InChI | InChI=1S/C27H33FN4O6SSi/c1-35-20-13-21(23(28)22(14-20)36-2)24(25(39-4)32-27(34)37-3)31-19-9-8-17(15-29)18(12-19)16-30-26(33)38-10-11-40(5,6)7/h8-9,12-14H,10-11,16H2,1-7H3,(H,30,33)/b31-24-,32-25- |
| InChIKey | JSOYZPABUZVOQJ-HOELXUHLSA-N |
| XLogP | 5.93 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.73 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|