C28H36FN3O5SSi — CID 59517272
methyl (1Z)-2-[3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-fluoro-5-methoxyphenyl]-2-(4-cyanophenyl)imino-N-methoxycarbonylethanimidothioate (PubChem CID 59517272) has the molecular formula C28H36FN3O5SSi and a molecular weight of 573.76 g/mol. Its IUPAC name is methyl (1Z)-2-[3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-fluoro-5-methoxyphenyl]-2-(4-cyanophenyl)imino-N-methoxycarbonylethanimidothioate.
| Compound Name | methyl (1Z)-2-[3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-fluoro-5-methoxyphenyl]-2-(4-cyanophenyl)imino-N-methoxycarbonylethanimidothioate |
|---|---|
| PubChem CID | 59517272 |
| Molecular Formula | C28H36FN3O5SSi |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | methyl (1Z)-2-[3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-fluoro-5-methoxyphenyl]-2-(4-cyanophenyl)imino-N-methoxycarbonylethanimidothioate |
| SMILES | COC(=O)/N=C(SC)/C(=N\c1ccc(C#N)cc1)c1cc(OC)cc(OCCCO[Si](C)(C)C(C)(C)C)c1F |
| InChI | InChI=1S/C28H36FN3O5SSi/c1-28(2,3)39(7,8)37-15-9-14-36-23-17-21(34-4)16-22(24(23)29)25(26(38-6)32-27(33)35-5)31-20-12-10-19(18-30)11-13-20/h10-13,16-17H,9,14-15H2,1-8H3/b31-25-,32-26- |
| InChIKey | PGAXOHIAPIXOOY-WVMMTVHUSA-N |
| XLogP | 7.15 |
| TPSA | 102.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|