C15H17N3O4S — CID 173472121
methyl 2-[3-(cyanomethyl)-4,5-dimethoxyphenyl]-2-imino-N-methoxycarbonylethanimidothioate (PubChem CID 173472121) has the molecular formula C15H17N3O4S and a molecular weight of 335.39 g/mol. Its IUPAC name is methyl 2-[3-(cyanomethyl)-4,5-dimethoxyphenyl]-2-imino-N-methoxycarbonylethanimidothioate.
| Compound Name | methyl 2-[3-(cyanomethyl)-4,5-dimethoxyphenyl]-2-imino-N-methoxycarbonylethanimidothioate |
|---|---|
| PubChem CID | 173472121 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | methyl 2-[3-(cyanomethyl)-4,5-dimethoxyphenyl]-2-imino-N-methoxycarbonylethanimidothioate |
| SMILES | [H]/N=C(\C(=NC(=O)OC)SC)c1cc(CC#N)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H17N3O4S/c1-20-11-8-10(7-9(5-6-16)13(11)21-2)12(17)14(23-4)18-15(19)22-3/h7-8,17H,5H2,1-4H3/b17-12-,18-14? |
| InChIKey | ITPSXVZXGSHCHL-BEYZRBDUSA-N |
| XLogP | 2.67 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|