C12H16N2O4S — CID 146026326
methyl N-(3,4,5-trimethoxybenzoyl)carbamimidothioate (PubChem CID 146026326) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is methyl N-(3,4,5-trimethoxybenzoyl)carbamimidothioate.
| Compound Name | methyl N-(3,4,5-trimethoxybenzoyl)carbamimidothioate |
|---|---|
| PubChem CID | 146026326 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | methyl N-(3,4,5-trimethoxybenzoyl)carbamimidothioate |
| SMILES | [H]/N=C(/NC(=O)c1cc(OC)c(OC)c(OC)c1)SC |
| InChI | InChI=1S/C12H16N2O4S/c1-16-8-5-7(11(15)14-12(13)19-4)6-9(17-2)10(8)18-3/h5-6H,1-4H3,(H2,13,14,15) |
| InChIKey | VBTHLFZBCZZNPU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|