C16H22N2O5S — CID 173472116
methyl 2-[3,4-dimethoxy-5-(2-methoxyethyl)phenyl]-2-imino-N-methoxycarbonylethanimidothioate (PubChem CID 173472116) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is methyl 2-[3,4-dimethoxy-5-(2-methoxyethyl)phenyl]-2-imino-N-methoxycarbonylethanimidothioate.
| Compound Name | methyl 2-[3,4-dimethoxy-5-(2-methoxyethyl)phenyl]-2-imino-N-methoxycarbonylethanimidothioate |
|---|---|
| PubChem CID | 173472116 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | methyl 2-[3,4-dimethoxy-5-(2-methoxyethyl)phenyl]-2-imino-N-methoxycarbonylethanimidothioate |
| SMILES | [H]/N=C(\C(=NC(=O)OC)SC)c1cc(CCOC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H22N2O5S/c1-20-7-6-10-8-11(9-12(21-2)14(10)22-3)13(17)15(24-5)18-16(19)23-4/h8-9,17H,6-7H2,1-5H3/b17-13-,18-15? |
| InChIKey | CJXOMLJYHVFRDM-BZZOGBOMSA-N |
| XLogP | 2.79 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|