C27H34FN3O5SSi — CID 59516958
methyl (1Z)-2-[3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-fluoro-5-methoxyphenyl]-2-(4-cyanophenyl)imino-N-methoxycarbonylethanimidothioate (PubChem CID 59516958) has the molecular formula C27H34FN3O5SSi and a molecular weight of 559.74 g/mol. Its IUPAC name is methyl (1Z)-2-[3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-fluoro-5-methoxyphenyl]-2-(4-cyanophenyl)imino-N-methoxycarbonylethanimidothioate.
| Compound Name | methyl (1Z)-2-[3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-fluoro-5-methoxyphenyl]-2-(4-cyanophenyl)imino-N-methoxycarbonylethanimidothioate |
|---|---|
| PubChem CID | 59516958 |
| Molecular Formula | C27H34FN3O5SSi |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | methyl (1Z)-2-[3-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-fluoro-5-methoxyphenyl]-2-(4-cyanophenyl)imino-N-methoxycarbonylethanimidothioate |
| SMILES | COC(=O)/N=C(SC)/C(=N\c1ccc(C#N)cc1)c1cc(OC)cc(OCCO[Si](C)(C)C(C)(C)C)c1F |
| InChI | InChI=1S/C27H34FN3O5SSi/c1-27(2,3)38(7,8)36-14-13-35-22-16-20(33-4)15-21(23(22)28)24(25(37-6)31-26(32)34-5)30-19-11-9-18(17-29)10-12-19/h9-12,15-16H,13-14H2,1-8H3/b30-24-,31-25- |
| InChIKey | JVHGFLRJNVMMPH-ZPEMYOGYSA-N |
| XLogP | 6.76 |
| TPSA | 102.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|