C10H18F2O — CID 173492796
(E)-6,6-difluoro-5,5-dimethyloct-2-en-2-ol (PubChem CID 173492796) has the molecular formula C10H18F2O and a molecular weight of 192.25 g/mol. Its IUPAC name is (E)-6,6-difluoro-5,5-dimethyloct-2-en-2-ol.
| Compound Name | (E)-6,6-difluoro-5,5-dimethyloct-2-en-2-ol |
|---|---|
| PubChem CID | 173492796 |
| Molecular Formula | C10H18F2O |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (E)-6,6-difluoro-5,5-dimethyloct-2-en-2-ol |
| SMILES | CCC(F)(F)C(C)(C)C/C=C(\C)O |
| InChI | InChI=1S/C10H18F2O/c1-5-10(11,12)9(3,4)7-6-8(2)13/h6,13H,5,7H2,1-4H3/b8-6+ |
| InChIKey | VHENMJKOPAJVLO-SOFGYWHQSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|