C23H26N4O5 — CID 17349536
N-[3-[(E)-C-methyl-N-[[2-(4-methyl-2-nitrophenoxy)acetyl]amino]carbonimidoyl]phenyl]cyclopentanecarboxamide (PubChem CID 17349536) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is N-[3-[(E)-C-methyl-N-[[2-(4-methyl-2-nitrophenoxy)acetyl]amino]carbonimidoyl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[(E)-C-methyl-N-[[2-(4-methyl-2-nitrophenoxy)acetyl]amino]carbonimidoyl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 17349536 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-[3-[(E)-C-methyl-N-[[2-(4-methyl-2-nitrophenoxy)acetyl]amino]carbonimidoyl]phenyl]cyclopentanecarboxamide |
| SMILES | C/C(=N\NC(=O)COc1ccc(C)cc1[N+](=O)[O-])c1cccc(NC(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C23H26N4O5/c1-15-10-11-21(20(12-15)27(30)31)32-14-22(28)26-25-16(2)18-8-5-9-19(13-18)24-23(29)17-6-3-4-7-17/h5,8-13,17H,3-4,6-7,14H2,1-2H3,(H,24,29)(H,26,28)/b25-16+ |
| InChIKey | YREDGKNESMGRAE-PCLIKHOPSA-N |
| XLogP | 3.95 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|