C24H22ClF3N8O — CID 173498118
1-[4-[6-(3-chloro-4-pyridinyl)-5-[4-(trifluoromethyl)phenyl]-2-pyridinyl]piperazin-1-yl]-2-(2-hydrazinylidenehydrazinyl)prop-2-en-1-one (PubChem CID 173498118) has the molecular formula C24H22ClF3N8O and a molecular weight of 530.94 g/mol. Its IUPAC name is 1-[4-[6-(3-chloro-4-pyridinyl)-5-[4-(trifluoromethyl)phenyl]-2-pyridinyl]piperazin-1-yl]-2-(2-hydrazinylidenehydrazinyl)prop-2-en-1-one.
| Compound Name | 1-[4-[6-(3-chloro-4-pyridinyl)-5-[4-(trifluoromethyl)phenyl]-2-pyridinyl]piperazin-1-yl]-2-(2-hydrazinylidenehydrazinyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 173498118 |
| Molecular Formula | C24H22ClF3N8O |
| Molecular Weight | 530.94 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 1-[4-[6-(3-chloro-4-pyridinyl)-5-[4-(trifluoromethyl)phenyl]-2-pyridinyl]piperazin-1-yl]-2-(2-hydrazinylidenehydrazinyl)prop-2-en-1-one |
| SMILES | C=C(NN=NN)C(=O)N1CCN(c2ccc(-c3ccc(C(F)(F)F)cc3)c(-c3ccncc3Cl)n2)CC1 |
| InChI | InChI=1S/C24H22ClF3N8O/c1-15(32-34-33-29)23(37)36-12-10-35(11-13-36)21-7-6-18(16-2-4-17(5-3-16)24(26,27)28)22(31-21)19-8-9-30-14-20(19)25/h2-9,14H,1,10-13H2,(H2,29,34)(H,32,33) |
| InChIKey | FCKJHGPLGWYSTP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 112.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.94 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|