C19H19BrN2O2 — CID 17350704
5-bromo-N-(4-cyanophenyl)-2-(3-methylbutoxy)benzamide (PubChem CID 17350704) has the molecular formula C19H19BrN2O2 and a molecular weight of 387.28 g/mol. Its IUPAC name is 5-bromo-N-(4-cyanophenyl)-2-(3-methylbutoxy)benzamide.
| Compound Name | 5-bromo-N-(4-cyanophenyl)-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17350704 |
| Molecular Formula | C19H19BrN2O2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 5-bromo-N-(4-cyanophenyl)-2-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(Br)cc1C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H19BrN2O2/c1-13(2)9-10-24-18-8-5-15(20)11-17(18)19(23)22-16-6-3-14(12-21)4-7-16/h3-8,11,13H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | PUXHHMJTTDEBGV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |