C29H25N3O5 — CID 17361709
N-[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide (PubChem CID 17361709) has the molecular formula C29H25N3O5 and a molecular weight of 495.54 g/mol. Its IUPAC name is N-[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 17361709 |
| Molecular Formula | C29H25N3O5 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | N-[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxamide |
| SMILES | Cc1ccc2oc(-c3ccc(C)c(NC(=O)c4ccc5c(c4)C(=O)N(CC4CCCO4)C5=O)c3)nc2c1 |
| InChI | InChI=1S/C29H25N3O5/c1-16-5-10-25-24(12-16)31-27(37-25)19-7-6-17(2)23(14-19)30-26(33)18-8-9-21-22(13-18)29(35)32(28(21)34)15-20-4-3-11-36-20/h5-10,12-14,20H,3-4,11,15H2,1-2H3,(H,30,33) |
| InChIKey | ZPSXBEQOHCSHCV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|