C26H28N2O7 — CID 17366104
(2,3-dimethoxyphenyl)-[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methanone;oxalic acid (PubChem CID 17366104) has the molecular formula C26H28N2O7 and a molecular weight of 480.52 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)-[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methanone;oxalic acid.
| Compound Name | (2,3-dimethoxyphenyl)-[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 17366104 |
| Molecular Formula | C26H28N2O7 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (2,3-dimethoxyphenyl)-[4-(naphthalen-2-ylmethyl)piperazin-1-yl]methanone;oxalic acid |
| SMILES | COc1cccc(C(=O)N2CCN(Cc3ccc4ccccc4c3)CC2)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H26N2O3.C2H2O4/c1-28-22-9-5-8-21(23(22)29-2)24(27)26-14-12-25(13-15-26)17-18-10-11-19-6-3-4-7-20(19)16-18;3-1(4)2(5)6/h3-11,16H,12-15,17H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | OSEUYBNIQRPVFD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|