C21H25N3O7 — CID 90483246
(2,3-dimethoxyphenyl)-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone;oxalic acid (PubChem CID 90483246) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone;oxalic acid.
| Compound Name | (2,3-dimethoxyphenyl)-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 90483246 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (2,3-dimethoxyphenyl)-[4-(pyridin-4-ylmethyl)piperazin-1-yl]methanone;oxalic acid |
| SMILES | COc1cccc(C(=O)N2CCN(Cc3ccncc3)CC2)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H23N3O3.C2H2O4/c1-24-17-5-3-4-16(18(17)25-2)19(23)22-12-10-21(11-13-22)14-15-6-8-20-9-7-15;3-1(4)2(5)6/h3-9H,10-14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | DUJLKBWKGVIKRW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|