C15H19F3N2O6S — CID 17366179
1-methylsulfonyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid (PubChem CID 17366179) has the molecular formula C15H19F3N2O6S and a molecular weight of 412.39 g/mol. Its IUPAC name is 1-methylsulfonyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid.
| Compound Name | 1-methylsulfonyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 17366179 |
| Molecular Formula | C15H19F3N2O6S |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-methylsulfonyl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid |
| SMILES | CS(=O)(=O)N1CCN(Cc2ccccc2C(F)(F)F)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C13H17F3N2O2S.C2H2O4/c1-21(19,20)18-8-6-17(7-9-18)10-11-4-2-3-5-12(11)13(14,15)16;3-1(4)2(5)6/h2-5H,6-10H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JSCIDUQHNIPKNV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|