C18H25F3N2O4 — CID 17369798
1-butan-2-yl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid (PubChem CID 17369798) has the molecular formula C18H25F3N2O4 and a molecular weight of 390.40 g/mol. Its IUPAC name is 1-butan-2-yl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid.
| Compound Name | 1-butan-2-yl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 17369798 |
| Molecular Formula | C18H25F3N2O4 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 1-butan-2-yl-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid |
| SMILES | CCC(C)N1CCN(Cc2ccccc2C(F)(F)F)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H23F3N2.C2H2O4/c1-3-13(2)21-10-8-20(9-11-21)12-14-6-4-5-7-15(14)16(17,18)19;3-1(4)2(5)6/h4-7,13H,3,8-12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | DICJJXYAEPWQFL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|