C19H17N3O3S — CID 17370494
1-(1,3-benzodioxol-5-ylmethyl)-1-(furan-2-ylmethyl)-3-pyridin-3-ylthiourea (PubChem CID 17370494) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-(furan-2-ylmethyl)-3-pyridin-3-ylthiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-(furan-2-ylmethyl)-3-pyridin-3-ylthiourea |
|---|---|
| PubChem CID | 17370494 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-(furan-2-ylmethyl)-3-pyridin-3-ylthiourea |
| SMILES | S=C(Nc1cccnc1)N(Cc1ccc2c(c1)OCO2)Cc1ccco1 |
| InChI | InChI=1S/C19H17N3O3S/c26-19(21-15-3-1-7-20-10-15)22(12-16-4-2-8-23-16)11-14-5-6-17-18(9-14)25-13-24-17/h1-10H,11-13H2,(H,21,26) |
| InChIKey | FIQGMUIPMZLJQQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|