C17H18N2O3 — CID 17373364
methyl 4-[(E)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]benzoate (PubChem CID 17373364) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is methyl 4-[(E)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 17373364 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | methyl 4-[(E)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(\C#N)C(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C17H18N2O3/c1-22-17(21)13-8-6-12(7-9-13)10-14(11-18)16(20)19-15-4-2-3-5-15/h6-10,15H,2-5H2,1H3,(H,19,20)/b14-10+ |
| InChIKey | CNNFNMRGNMJQKW-GXDHUFHOSA-N |
| XLogP | 2.44 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|