C10H9F2N3S — CID 17373708
4-(2,4-difluorophenyl)-3-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 17373708) has the molecular formula C10H9F2N3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-3-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2,4-difluorophenyl)-3-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 17373708 |
| Molecular Formula | C10H9F2N3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 4-(2,4-difluorophenyl)-3-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1n[nH]c(=S)n1-c1ccc(F)cc1F |
| InChI | InChI=1S/C10H9F2N3S/c1-2-9-13-14-10(16)15(9)8-4-3-6(11)5-7(8)12/h3-5H,2H2,1H3,(H,14,16) |
| InChIKey | CNJHAMGYJKTNDD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|