C15H14N4OS2 — CID 17378063
2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 17378063) has the molecular formula C15H14N4OS2 and a molecular weight of 330.44 g/mol. Its IUPAC name is 2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | 2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 17378063 |
| Molecular Formula | C15H14N4OS2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(N)=O)nnc1-c1csc2ccccc12 |
| InChI | InChI=1S/C15H14N4OS2/c1-2-7-19-14(17-18-15(19)22-9-13(16)20)11-8-21-12-6-4-3-5-10(11)12/h2-6,8H,1,7,9H2,(H2,16,20) |
| InChIKey | CJCJGHAQSCUGPJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|