C23H22N4OS2 — CID 19723639
2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dimethylphenyl)acetamide (PubChem CID 19723639) has the molecular formula C23H22N4OS2 and a molecular weight of 434.59 g/mol. Its IUPAC name is 2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 19723639 |
| Molecular Formula | C23H22N4OS2 |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dimethylphenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cc(C)ccc2C)nnc1-c1csc2ccccc12 |
| InChI | InChI=1S/C23H22N4OS2/c1-4-11-27-22(18-13-29-20-8-6-5-7-17(18)20)25-26-23(27)30-14-21(28)24-19-12-15(2)9-10-16(19)3/h4-10,12-13H,1,11,14H2,2-3H3,(H,24,28) |
| InChIKey | UBYYKCSUYCIRAY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|