C22H20N4OS2 — CID 19723635
2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylphenyl)acetamide (PubChem CID 19723635) has the molecular formula C22H20N4OS2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19723635 |
| Molecular Formula | C22H20N4OS2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-[[5-(1-benzothiophen-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-methylphenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc(C)c2)nnc1-c1csc2ccccc12 |
| InChI | InChI=1S/C22H20N4OS2/c1-3-11-26-21(18-13-28-19-10-5-4-9-17(18)19)24-25-22(26)29-14-20(27)23-16-8-6-7-15(2)12-16/h3-10,12-13H,1,11,14H2,2H3,(H,23,27) |
| InChIKey | YQBGJHGMFVSCEH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|