C23H18N4O3S — CID 17379748
N-[3-cyano-5-(dimethylcarbamoyl)-4-methylthiophen-2-yl]-3-iminobenzo[f]chromene-2-carboxamide (PubChem CID 17379748) has the molecular formula C23H18N4O3S and a molecular weight of 430.49 g/mol. Its IUPAC name is N-[3-cyano-5-(dimethylcarbamoyl)-4-methylthiophen-2-yl]-3-iminobenzo[f]chromene-2-carboxamide.
| Compound Name | N-[3-cyano-5-(dimethylcarbamoyl)-4-methylthiophen-2-yl]-3-iminobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 17379748 |
| Molecular Formula | C23H18N4O3S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N-[3-cyano-5-(dimethylcarbamoyl)-4-methylthiophen-2-yl]-3-iminobenzo[f]chromene-2-carboxamide |
| SMILES | [H]/N=c1\oc2ccc3ccccc3c2cc1C(=O)Nc1sc(C(=O)N(C)C)c(C)c1C#N |
| InChI | InChI=1S/C23H18N4O3S/c1-12-17(11-24)22(31-19(12)23(29)27(2)3)26-21(28)16-10-15-14-7-5-4-6-13(14)8-9-18(15)30-20(16)25/h4-10,25H,1-3H3,(H,26,28)/b25-20- |
| InChIKey | AXSYERURIPKGHB-QQTULTPQSA-N |
| XLogP | 4.26 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|