C24H25N3OS — CID 17382537
N-[3-(dibenzylcarbamothioylamino)phenyl]propanamide (PubChem CID 17382537) has the molecular formula C24H25N3OS and a molecular weight of 403.55 g/mol. Its IUPAC name is N-[3-(dibenzylcarbamothioylamino)phenyl]propanamide.
| Compound Name | N-[3-(dibenzylcarbamothioylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 17382537 |
| Molecular Formula | C24H25N3OS |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | N-[3-(dibenzylcarbamothioylamino)phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(NC(=S)N(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H25N3OS/c1-2-23(28)25-21-14-9-15-22(16-21)26-24(29)27(17-19-10-5-3-6-11-19)18-20-12-7-4-8-13-20/h3-16H,2,17-18H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | SQVZFAPPAYWQMP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|