C17H20ClN3 — CID 17384327
2-amino-6-tert-butyl-4-(4-methylphenyl)pyridine-3-carbonitrile;hydrochloride (PubChem CID 17384327) has the molecular formula C17H20ClN3 and a molecular weight of 301.82 g/mol. Its IUPAC name is 2-amino-6-tert-butyl-4-(4-methylphenyl)pyridine-3-carbonitrile;hydrochloride.
| Compound Name | 2-amino-6-tert-butyl-4-(4-methylphenyl)pyridine-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 17384327 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-amino-6-tert-butyl-4-(4-methylphenyl)pyridine-3-carbonitrile;hydrochloride |
| SMILES | Cc1ccc(-c2cc(C(C)(C)C)nc(N)c2C#N)cc1.Cl |
| InChI | InChI=1S/C17H19N3.ClH/c1-11-5-7-12(8-6-11)13-9-15(17(2,3)4)20-16(19)14(13)10-18;/h5-9H,1-4H3,(H2,19,20);1H |
| InChIKey | FILBKLKDOITPSW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |