C20H25ClN4O2S2 — CID 17384563
N-[3-chloro-4-[(2-piperidin-1-yl-2-sulfanylideneacetyl)amino]phenyl]-2-piperidin-1-yl-2-sulfanylideneacetamide (PubChem CID 17384563) has the molecular formula C20H25ClN4O2S2 and a molecular weight of 453.03 g/mol. Its IUPAC name is N-[3-chloro-4-[(2-piperidin-1-yl-2-sulfanylideneacetyl)amino]phenyl]-2-piperidin-1-yl-2-sulfanylideneacetamide.
| Compound Name | N-[3-chloro-4-[(2-piperidin-1-yl-2-sulfanylideneacetyl)amino]phenyl]-2-piperidin-1-yl-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 17384563 |
| Molecular Formula | C20H25ClN4O2S2 |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | N-[3-chloro-4-[(2-piperidin-1-yl-2-sulfanylideneacetyl)amino]phenyl]-2-piperidin-1-yl-2-sulfanylideneacetamide |
| SMILES | O=C(Nc1ccc(NC(=O)C(=S)N2CCCCC2)c(Cl)c1)C(=S)N1CCCCC1 |
| InChI | InChI=1S/C20H25ClN4O2S2/c21-15-13-14(22-17(26)19(28)24-9-3-1-4-10-24)7-8-16(15)23-18(27)20(29)25-11-5-2-6-12-25/h7-8,13H,1-6,9-12H2,(H,22,26)(H,23,27) |
| InChIKey | KNCDNMWYPMZZIR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|