C12H11Cl3N2O2S — CID 91902466
2-morpholin-4-yl-2-sulfanylidene-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 91902466) has the molecular formula C12H11Cl3N2O2S and a molecular weight of 353.66 g/mol. Its IUPAC name is 2-morpholin-4-yl-2-sulfanylidene-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-morpholin-4-yl-2-sulfanylidene-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 91902466 |
| Molecular Formula | C12H11Cl3N2O2S |
| Molecular Weight | 353.66 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | 2-morpholin-4-yl-2-sulfanylidene-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C(=S)N1CCOCC1 |
| InChI | InChI=1S/C12H11Cl3N2O2S/c13-7-5-9(15)10(6-8(7)14)16-11(18)12(20)17-1-3-19-4-2-17/h5-6H,1-4H2,(H,16,18) |
| InChIKey | GNYPYPDQMZQETR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.66 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|