C12H12Cl2N2O2S — CID 91902464
N-(2,3-dichlorophenyl)-2-morpholin-4-yl-2-sulfanylideneacetamide (PubChem CID 91902464) has the molecular formula C12H12Cl2N2O2S and a molecular weight of 319.21 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-morpholin-4-yl-2-sulfanylideneacetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-morpholin-4-yl-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 91902464 |
| Molecular Formula | C12H12Cl2N2O2S |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-morpholin-4-yl-2-sulfanylideneacetamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)C(=S)N1CCOCC1 |
| InChI | InChI=1S/C12H12Cl2N2O2S/c13-8-2-1-3-9(10(8)14)15-11(17)12(19)16-4-6-18-7-5-16/h1-3H,4-7H2,(H,15,17) |
| InChIKey | PITVVLFPIMRYRK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|