C17H16N4OS — CID 17385990
N,N-bis(2-cyanoethyl)-2-quinolin-8-ylsulfanylacetamide (PubChem CID 17385990) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-quinolin-8-ylsulfanylacetamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-quinolin-8-ylsulfanylacetamide |
|---|---|
| PubChem CID | 17385990 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-quinolin-8-ylsulfanylacetamide |
| SMILES | N#CCCN(CCC#N)C(=O)CSc1cccc2cccnc12 |
| InChI | InChI=1S/C17H16N4OS/c18-8-3-11-21(12-4-9-19)16(22)13-23-15-7-1-5-14-6-2-10-20-17(14)15/h1-2,5-7,10H,3-4,11-13H2 |
| InChIKey | BATTXWOMFMFECY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |