C11H12N4OS2 — CID 47365109
N,N-bis(2-cyanoethyl)-2-(1,3-thiazol-2-ylsulfanyl)acetamide (PubChem CID 47365109) has the molecular formula C11H12N4OS2 and a molecular weight of 280.38 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-(1,3-thiazol-2-ylsulfanyl)acetamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-(1,3-thiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 47365109 |
| Molecular Formula | C11H12N4OS2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-(1,3-thiazol-2-ylsulfanyl)acetamide |
| SMILES | N#CCCN(CCC#N)C(=O)CSc1nccs1 |
| InChI | InChI=1S/C11H12N4OS2/c12-3-1-6-15(7-2-4-13)10(16)9-18-11-14-5-8-17-11/h5,8H,1-2,6-7,9H2 |
| InChIKey | VVDUTPIITXBGBH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|