C8H4F11NO — CID 17386519
1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-methylcyclohexane-1-carboxamide (PubChem CID 17386519) has the molecular formula C8H4F11NO and a molecular weight of 339.10 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-methylcyclohexane-1-carboxamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 17386519 |
| Molecular Formula | C8H4F11NO |
| Molecular Weight | 339.10 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-methylcyclohexane-1-carboxamide |
| SMILES | CNC(=O)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H4F11NO/c1-20-2(21)3(9)4(10,11)6(14,15)8(18,19)7(16,17)5(3,12)13/h1H3,(H,20,21) |
| InChIKey | BBGKKHQZJFMAPX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.10 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|