C16H16N8O2 — CID 17387798
N-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine (PubChem CID 17387798) has the molecular formula C16H16N8O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is N-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine.
| Compound Name | N-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 17387798 |
| Molecular Formula | C16H16N8O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[(E)-1-(1,3-benzodioxol-5-yl)ethylideneamino]-6-(3,5-dimethylpyrazol-1-yl)-1,2,4,5-tetrazin-3-amine |
| SMILES | C/C(=N\Nc1nnc(-n2nc(C)cc2C)nn1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H16N8O2/c1-9-6-10(2)24(23-9)16-21-19-15(20-22-16)18-17-11(3)12-4-5-13-14(7-12)26-8-25-13/h4-7H,8H2,1-3H3,(H,18,19,20)/b17-11+ |
| InChIKey | IEOFYWIFAFGECA-GZTJUZNOSA-N |
| XLogP | 1.63 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|