C23H38IN4O4P — CID 17389152
(2,4-dimorpholin-4-ylphenyl)-methyl-dimorpholin-4-ylphosphanium iodide (PubChem CID 17389152) has the molecular formula C23H38IN4O4P and a molecular weight of 592.46 g/mol. Its IUPAC name is (2,4-dimorpholin-4-ylphenyl)-methyl-dimorpholin-4-ylphosphanium iodide.
| Compound Name | (2,4-dimorpholin-4-ylphenyl)-methyl-dimorpholin-4-ylphosphanium iodide |
|---|---|
| PubChem CID | 17389152 |
| Molecular Formula | C23H38IN4O4P |
| Molecular Weight | 592.46 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | (2,4-dimorpholin-4-ylphenyl)-methyl-dimorpholin-4-ylphosphanium iodide |
| SMILES | C[P+](c1ccc(N2CCOCC2)cc1N1CCOCC1)(N1CCOCC1)N1CCOCC1.[I-] |
| InChI | InChI=1S/C23H38N4O4P.HI/c1-32(26-8-16-30-17-9-26,27-10-18-31-19-11-27)23-3-2-21(24-4-12-28-13-5-24)20-22(23)25-6-14-29-15-7-25;/h2-3,20H,4-19H2,1H3;1H/q+1;/p-1 |
| InChIKey | CDMXSBITZDRYJN-UHFFFAOYSA-M |
| XLogP | -1.87 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.46 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|