C23H38N4O4P+ — CID 3782963
(2,4-dimorpholin-4-ylphenyl)-methyl-dimorpholin-4-ylphosphanium (PubChem CID 3782963) has the molecular formula C23H38N4O4P+ and a molecular weight of 465.56 g/mol. Its IUPAC name is (2,4-dimorpholin-4-ylphenyl)-methyl-dimorpholin-4-ylphosphanium.
| Compound Name | (2,4-dimorpholin-4-ylphenyl)-methyl-dimorpholin-4-ylphosphanium |
|---|---|
| PubChem CID | 3782963 |
| Molecular Formula | C23H38N4O4P+ |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | (2,4-dimorpholin-4-ylphenyl)-methyl-dimorpholin-4-ylphosphanium |
| SMILES | C[P+](c1ccc(N2CCOCC2)cc1N1CCOCC1)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C23H38N4O4P/c1-32(26-8-16-30-17-9-26,27-10-18-31-19-11-27)23-3-2-21(24-4-12-28-13-5-24)20-22(23)25-6-14-29-15-7-25/h2-3,20H,4-19H2,1H3/q+1 |
| InChIKey | LSLBQDAFOHEAJN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|