C26H20BrClN2O4S — CID 17389365
(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 17389365) has the molecular formula C26H20BrClN2O4S and a molecular weight of 571.88 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 17389365 |
| Molecular Formula | C26H20BrClN2O4S |
| Molecular Weight | 571.88 g/mol |
| Exact Mass | 570.00 |
| IUPAC Name | (5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCOc1cc(/C=C2/C(=O)NC(=S)N(c3ccccc3)C2=O)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H20BrClN2O4S/c1-2-33-22-14-17(13-21(27)23(22)34-15-16-8-10-18(28)11-9-16)12-20-24(31)29-26(35)30(25(20)32)19-6-4-3-5-7-19/h3-14H,2,15H2,1H3,(H,29,31,35)/b20-12- |
| InChIKey | VARFFRUIWOECOB-NDENLUEZSA-N |
| XLogP | 5.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.88 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|