C15H15N3O3 — CID 17397799
2,5-dimethyl-N'-(2-nitrophenyl)benzohydrazide (PubChem CID 17397799) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2,5-dimethyl-N'-(2-nitrophenyl)benzohydrazide.
| Compound Name | 2,5-dimethyl-N'-(2-nitrophenyl)benzohydrazide |
|---|---|
| PubChem CID | 17397799 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2,5-dimethyl-N'-(2-nitrophenyl)benzohydrazide |
| SMILES | Cc1ccc(C)c(C(=O)NNc2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15N3O3/c1-10-7-8-11(2)12(9-10)15(19)17-16-13-5-3-4-6-14(13)18(20)21/h3-9,16H,1-2H3,(H,17,19) |
| InChIKey | AMJLRUCYWQULLF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|