C16H14B5N3O2 — CID 174001182
CID 174001182 (PubChem CID 174001182) has the molecular formula C16H14B5N3O2 and a molecular weight of 334.37 g/mol.
| Compound Name | CID 174001182 |
|---|---|
| PubChem CID | 174001182 |
| Molecular Formula | C16H14B5N3O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c([C@H](C)Nc2cc(=O)n(C3CCC3)c(=O)[nH]2)c([B])c1[B] |
| InChI | InChI=1S/C16H14B5N3O2/c1-6(10-11(17)13(19)15(21)14(20)12(10)18)22-8-5-9(25)24(16(26)23-8)7-3-2-4-7/h5-7,22H,2-4H2,1H3,(H,23,26)/t6-/m0/s1 |
| InChIKey | FEWVYSHHLHJHFB-LURJTMIESA-N |
| XLogP | -3.60 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|