C18H30FN3O2 — CID 174001455
2-[(6R)-4-[3-(4-fluorophenoxy)propyl]-6-methoxy-1,4-diazepan-1-yl]-N-methylethanamine (PubChem CID 174001455) has the molecular formula C18H30FN3O2 and a molecular weight of 339.45 g/mol. Its IUPAC name is 2-[(6R)-4-[3-(4-fluorophenoxy)propyl]-6-methoxy-1,4-diazepan-1-yl]-N-methylethanamine.
| Compound Name | 2-[(6R)-4-[3-(4-fluorophenoxy)propyl]-6-methoxy-1,4-diazepan-1-yl]-N-methylethanamine |
|---|---|
| PubChem CID | 174001455 |
| Molecular Formula | C18H30FN3O2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | 2-[(6R)-4-[3-(4-fluorophenoxy)propyl]-6-methoxy-1,4-diazepan-1-yl]-N-methylethanamine |
| SMILES | CNCCN1CCN(CCCOc2ccc(F)cc2)C[C@@H](OC)C1 |
| InChI | InChI=1S/C18H30FN3O2/c1-20-8-10-22-12-11-21(14-18(15-22)23-2)9-3-13-24-17-6-4-16(19)5-7-17/h4-7,18,20H,3,8-15H2,1-2H3/t18-/m1/s1 |
| InChIKey | PDHMJUVPZUCWJE-GOSISDBHSA-N |
| XLogP | 1.45 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|