About tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate
tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate (PubChem CID 174002127) has the molecular formula C13H27NO3Si
and a molecular weight of 273.45 g/mol. Its IUPAC name is tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate |
| PubChem CID | 174002127 |
| Molecular Formula | C13H27NO3Si |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate |
| SMILES | C[SiH2][C@]1(NC(=O)OC(C)(C)C)CCC(C)(C)OC1 |
| InChI | InChI=1S/C13H27NO3Si/c1-11(2,3)17-10(15)14-13(18-6)8-7-12(4,5)16-9-13/h7-9,18H2,1-6H3,(H,14,15)/t13-/m1/s1 |
| InChIKey | INYLNBFURXCWAA-CYBMUJFWSA-N |
| XLogP | 2.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate?
The IUPAC name of tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate (CID 174002127) is tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate is C[SiH2][C@]1(NC(=O)OC(C)(C)C)CCC(C)(C)OC1.
What is the InChIKey of tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate?
The InChIKey is INYLNBFURXCWAA-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H27NO3Si/c1-11(2,3)17-10(15)14-13(18-6)8-7-12(4,5)16-9-13/h7-9,18H2,1-6H3,(H,14,15)/t13-/m1/s1.
What are the key properties of tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate?
tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate has a molecular weight of 273.45 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(3R)-6,6-dimethyl-3-methylsilyloxan-3-yl]carbamate is sourced from PubChem (CID 174002127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).