C37H25NOSi — CID 174005051
4-[3-[dibenzofuran-3-yl(diphenyl)silyl]phenyl]benzonitrile (PubChem CID 174005051) has the molecular formula C37H25NOSi and a molecular weight of 527.70 g/mol. Its IUPAC name is 4-[3-[dibenzofuran-3-yl(diphenyl)silyl]phenyl]benzonitrile.
| Compound Name | 4-[3-[dibenzofuran-3-yl(diphenyl)silyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 174005051 |
| Molecular Formula | C37H25NOSi |
| Molecular Weight | 527.70 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 4-[3-[dibenzofuran-3-yl(diphenyl)silyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccc4c(c3)oc3ccccc34)c2)cc1 |
| InChI | InChI=1S/C37H25NOSi/c38-26-27-18-20-28(21-19-27)29-10-9-15-32(24-29)40(30-11-3-1-4-12-30,31-13-5-2-6-14-31)33-22-23-35-34-16-7-8-17-36(34)39-37(35)25-33/h1-25H |
| InChIKey | YMRZIMXGZLERRT-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.70 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|