C27H31N3O4 — CID 174005944
3-[6-[(6S)-6-[benzyl(methyl)amino]oxepan-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 174005944) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 3-[6-[(6S)-6-[benzyl(methyl)amino]oxepan-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(6S)-6-[benzyl(methyl)amino]oxepan-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174005944 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 3-[6-[(6S)-6-[benzyl(methyl)amino]oxepan-4-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CN(Cc1ccccc1)[C@@H]1COCCC(c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C27H31N3O4/c1-29(15-18-5-3-2-4-6-18)22-14-20(11-12-34-17-22)19-7-8-23-21(13-19)16-30(27(23)33)24-9-10-25(31)28-26(24)32/h2-8,13,20,22,24H,9-12,14-17H2,1H3,(H,28,31,32)/t20?,22-,24?/m0/s1 |
| InChIKey | CPJBIONJCHOINU-HMXGKDEJSA-N |
| XLogP | 2.84 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|