C21H25NOS — CID 174007762
1-[(3R)-3-methylcyclopentyl]-3-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]but-3-en-1-one (PubChem CID 174007762) has the molecular formula C21H25NOS and a molecular weight of 339.50 g/mol. Its IUPAC name is 1-[(3R)-3-methylcyclopentyl]-3-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]but-3-en-1-one.
| Compound Name | 1-[(3R)-3-methylcyclopentyl]-3-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]but-3-en-1-one |
|---|---|
| PubChem CID | 174007762 |
| Molecular Formula | C21H25NOS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-[(3R)-3-methylcyclopentyl]-3-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]but-3-en-1-one |
| SMILES | C=C(CC(=O)C1CC[C@@H](C)C1)Cc1ccc(-c2scnc2C)cc1 |
| InChI | InChI=1S/C21H25NOS/c1-14-4-7-19(11-14)20(23)12-15(2)10-17-5-8-18(9-6-17)21-16(3)22-13-24-21/h5-6,8-9,13-14,19H,2,4,7,10-12H2,1,3H3/t14-,19?/m1/s1 |
| InChIKey | KMNHHFRQGIYAIS-MJTSIZKDSA-N |
| XLogP | 5.61 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|