C13H13NS — CID 178063099
4-methyl-5-(4-prop-2-ynylphenyl)-1,3-thiazole;molecular hydrogen (PubChem CID 178063099) has the molecular formula C13H13NS and a molecular weight of 215.32 g/mol. Its IUPAC name is 4-methyl-5-(4-prop-2-ynylphenyl)-1,3-thiazole;molecular hydrogen.
| Compound Name | 4-methyl-5-(4-prop-2-ynylphenyl)-1,3-thiazole;molecular hydrogen |
|---|---|
| PubChem CID | 178063099 |
| Molecular Formula | C13H13NS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 4-methyl-5-(4-prop-2-ynylphenyl)-1,3-thiazole;molecular hydrogen |
| SMILES | C#CCc1ccc(-c2scnc2C)cc1.[H][H] |
| InChI | InChI=1S/C13H11NS.H2/c1-3-4-11-5-7-12(8-6-11)13-10(2)14-9-15-13;/h1,5-9H,4H2,2H3;1H |
| InChIKey | DUWMEFCZJAKYRJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|