C13H12N2OS — CID 174303519
2-[(ethynylamino)methyl]-5-(4-methyl-1,3-thiazol-5-yl)phenol (PubChem CID 174303519) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is 2-[(ethynylamino)methyl]-5-(4-methyl-1,3-thiazol-5-yl)phenol.
| Compound Name | 2-[(ethynylamino)methyl]-5-(4-methyl-1,3-thiazol-5-yl)phenol |
|---|---|
| PubChem CID | 174303519 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-[(ethynylamino)methyl]-5-(4-methyl-1,3-thiazol-5-yl)phenol |
| SMILES | C#CNCc1ccc(-c2scnc2C)cc1O |
| InChI | InChI=1S/C13H12N2OS/c1-3-14-7-11-5-4-10(6-12(11)16)13-9(2)15-8-17-13/h1,4-6,8,14,16H,7H2,2H3 |
| InChIKey | LLKYACKZIFVLFZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|