C13H17N3OS — CID 163266043
[2-ethyl-5-(4-methyl-1,3-thiazol-5-yl)phenoxy]methylhydrazine (PubChem CID 163266043) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is [2-ethyl-5-(4-methyl-1,3-thiazol-5-yl)phenoxy]methylhydrazine.
| Compound Name | [2-ethyl-5-(4-methyl-1,3-thiazol-5-yl)phenoxy]methylhydrazine |
|---|---|
| PubChem CID | 163266043 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | [2-ethyl-5-(4-methyl-1,3-thiazol-5-yl)phenoxy]methylhydrazine |
| SMILES | CCc1ccc(-c2scnc2C)cc1OCNN |
| InChI | InChI=1S/C13H17N3OS/c1-3-10-4-5-11(6-12(10)17-7-16-14)13-9(2)15-8-18-13/h4-6,8,16H,3,7,14H2,1-2H3 |
| InChIKey | ULDMZVXEAMKZQY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|