C21H25FN9O10P — CID 174011434
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3S,4S,5R)-4-fluoro-5-(2-hydroxyethyl)-2-(6-oxo-1H-purin-9-yl)oxolan-3-yl] hydrogen phosphate (PubChem CID 174011434) has the molecular formula C21H25FN9O10P and a molecular weight of 613.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3S,4S,5R)-4-fluoro-5-(2-hydroxyethyl)-2-(6-oxo-1H-purin-9-yl)oxolan-3-yl] hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3S,4S,5R)-4-fluoro-5-(2-hydroxyethyl)-2-(6-oxo-1H-purin-9-yl)oxolan-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 174011434 |
| Molecular Formula | C21H25FN9O10P |
| Molecular Weight | 613.46 g/mol |
| Exact Mass | 613.14 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3S,4S,5R)-4-fluoro-5-(2-hydroxyethyl)-2-(6-oxo-1H-purin-9-yl)oxolan-3-yl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O[C@@H]2[C@@H](F)[C@@H](CCO)O[C@H]2n2cnc3c(=O)[nH]cnc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H25FN9O10P/c22-10-8(1-2-32)39-21(31-7-29-12-18(31)26-5-27-19(12)35)15(10)41-42(36,37)38-3-9-13(33)14(34)20(40-9)30-6-28-11-16(23)24-4-25-17(11)30/h4-10,13-15,20-21,32-34H,1-3H2,(H,36,37)(H2,23,24,25)(H,26,27,35)/t8-,9-,10+,13-,14-,15-,20-,21-/m1/s1 |
| InChIKey | VWXYOZWURLIFQC-UZJYAAOJSA-N |
| XLogP | -1.72 |
| TPSA | 268.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.46 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|