C30H28BN — CID 174016202
CID 174016202 (PubChem CID 174016202) has the molecular formula C30H28BN and a molecular weight of 413.37 g/mol.
| Compound Name | CID 174016202 |
|---|---|
| PubChem CID | 174016202 |
| Molecular Formula | C30H28BN |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | — |
| SMILES | [B]c1cc2c(cc1Nc1ccc(-c3ccccc3)cc1)C(C)(C)c1ccccc1C2(C)C |
| InChI | InChI=1S/C30H28BN/c1-29(2)23-12-8-9-13-24(23)30(3,4)26-19-28(27(31)18-25(26)29)32-22-16-14-21(15-17-22)20-10-6-5-7-11-20/h5-19,32H,1-4H3 |
| InChIKey | CMFDGXPHPFWOKV-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|